C26H23N3O5 — CID 3894788
N'-benzoyl-4-methoxy-N'-[1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide (PubChem CID 3894788) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is N'-benzoyl-4-methoxy-N'-[1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide.
| Compound Name | N'-benzoyl-4-methoxy-N'-[1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide |
|---|---|
| PubChem CID | 3894788 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N'-benzoyl-4-methoxy-N'-[1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide |
| SMILES | COc1ccc(C(=O)NN(C(=O)c2ccccc2)C2CC(=O)N(c3cccc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C26H23N3O5/c1-17-7-6-10-20(15-17)28-23(30)16-22(26(28)33)29(25(32)19-8-4-3-5-9-19)27-24(31)18-11-13-21(34-2)14-12-18/h3-15,22H,16H2,1-2H3,(H,27,31) |
| InChIKey | JHPXYAKRFYYJAD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|