C25H20N4O7 — CID 4597658
N'-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N'-(4-methoxybenzoyl)-2-nitrobenzohydrazide (PubChem CID 4597658) has the molecular formula C25H20N4O7 and a molecular weight of 488.46 g/mol. Its IUPAC name is N'-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N'-(4-methoxybenzoyl)-2-nitrobenzohydrazide.
| Compound Name | N'-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N'-(4-methoxybenzoyl)-2-nitrobenzohydrazide |
|---|---|
| PubChem CID | 4597658 |
| Molecular Formula | C25H20N4O7 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | N'-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N'-(4-methoxybenzoyl)-2-nitrobenzohydrazide |
| SMILES | COc1ccc(C(=O)N(NC(=O)c2ccccc2[N+](=O)[O-])C2CC(=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H20N4O7/c1-36-18-13-11-16(12-14-18)24(32)28(26-23(31)19-9-5-6-10-20(19)29(34)35)21-15-22(30)27(25(21)33)17-7-3-2-4-8-17/h2-14,21H,15H2,1H3,(H,26,31) |
| InChIKey | OLTKXBHMPKYNKS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|