C21H20N4O7 — CID 3969845
N'-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitro-N'-propanoylbenzohydrazide (PubChem CID 3969845) has the molecular formula C21H20N4O7 and a molecular weight of 440.41 g/mol. Its IUPAC name is N'-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitro-N'-propanoylbenzohydrazide.
| Compound Name | N'-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitro-N'-propanoylbenzohydrazide |
|---|---|
| PubChem CID | 3969845 |
| Molecular Formula | C21H20N4O7 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N'-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitro-N'-propanoylbenzohydrazide |
| SMILES | CCC(=O)N(NC(=O)c1cccc([N+](=O)[O-])c1)C1CC(=O)N(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C21H20N4O7/c1-3-18(26)24(22-20(28)13-5-4-6-15(11-13)25(30)31)17-12-19(27)23(21(17)29)14-7-9-16(32-2)10-8-14/h4-11,17H,3,12H2,1-2H3,(H,22,28) |
| InChIKey | JKDSNXNDEMVLER-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|