C22H20N4O8 — CID 4554369
ethyl 4-[3-[acetyl-[(4-nitrobenzoyl)amino]amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 4554369) has the molecular formula C22H20N4O8 and a molecular weight of 468.42 g/mol. Its IUPAC name is ethyl 4-[3-[acetyl-[(4-nitrobenzoyl)amino]amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[acetyl-[(4-nitrobenzoyl)amino]amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 4554369 |
| Molecular Formula | C22H20N4O8 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | ethyl 4-[3-[acetyl-[(4-nitrobenzoyl)amino]amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N(NC(=O)c3ccc([N+](=O)[O-])cc3)C(C)=O)C2=O)cc1 |
| InChI | InChI=1S/C22H20N4O8/c1-3-34-22(31)15-6-8-16(9-7-15)24-19(28)12-18(21(24)30)25(13(2)27)23-20(29)14-4-10-17(11-5-14)26(32)33/h4-11,18H,3,12H2,1-2H3,(H,23,29) |
| InChIKey | WGYRAOZIICTHPC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 156.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|