C21H28N2O5 — CID 23998883
ethyl 4-[3-[butanoyl(tert-butyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23998883) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is ethyl 4-[3-[butanoyl(tert-butyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[butanoyl(tert-butyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23998883 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | ethyl 4-[3-[butanoyl(tert-butyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCCC(=O)N(C1CC(=O)N(c2ccc(C(=O)OCC)cc2)C1=O)C(C)(C)C |
| InChI | InChI=1S/C21H28N2O5/c1-6-8-17(24)23(21(3,4)5)16-13-18(25)22(19(16)26)15-11-9-14(10-12-15)20(27)28-7-2/h9-12,16H,6-8,13H2,1-5H3 |
| InChIKey | CUSDPKGVIWBTEL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|