C22H32N2O4 — CID 23743864
N-tert-butyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide (PubChem CID 23743864) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-tert-butyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide.
| Compound Name | N-tert-butyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 23743864 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | N-tert-butyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide |
| SMILES | CCOc1ccc(N2C(=O)CC(N(C(=O)CC(C)(C)C)C(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C22H32N2O4/c1-8-28-16-11-9-15(10-12-16)23-18(25)13-17(20(23)27)24(22(5,6)7)19(26)14-21(2,3)4/h9-12,17H,8,13-14H2,1-7H3 |
| InChIKey | ZANHAKDGPKAZQC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|