C27H36N2O4 — CID 23972675
N-tert-butyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide (PubChem CID 23972675) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is N-tert-butyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide.
| Compound Name | N-tert-butyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 23972675 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | N-tert-butyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide |
| SMILES | CCOc1ccc(N2C(=O)CC(N(C(=O)C34CC5CC(CC(C5)C3)C4)C(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C27H36N2O4/c1-5-33-21-8-6-20(7-9-21)28-23(30)13-22(24(28)31)29(26(2,3)4)25(32)27-14-17-10-18(15-27)12-19(11-17)16-27/h6-9,17-19,22H,5,10-16H2,1-4H3 |
| InChIKey | XVRQJZMVYCOUAW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|