C28H38N2O5 — CID 23916670
N-(2,2-dimethoxyethyl)-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]adamantane-1-carboxamide (PubChem CID 23916670) has the molecular formula C28H38N2O5 and a molecular weight of 482.62 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]adamantane-1-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 23916670 |
| Molecular Formula | C28H38N2O5 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]adamantane-1-carboxamide |
| SMILES | COC(CN(C(=O)C12CC3CC(CC(C3)C1)C2)C1CC(=O)N(c2ccc(C(C)C)cc2)C1=O)OC |
| InChI | InChI=1S/C28H38N2O5/c1-17(2)21-5-7-22(8-6-21)30-24(31)12-23(26(30)32)29(16-25(34-3)35-4)27(33)28-13-18-9-19(14-28)11-20(10-18)15-28/h5-8,17-20,23,25H,9-16H2,1-4H3 |
| InChIKey | PZNFMQLYDRCMGU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|