C29H31FN2O3 — CID 23774596
N-[(4-fluorophenyl)methyl]-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide (PubChem CID 23774596) has the molecular formula C29H31FN2O3 and a molecular weight of 474.58 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 23774596 |
| Molecular Formula | C29H31FN2O3 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide |
| SMILES | Cc1ccc(N2C(=O)CC(N(Cc3ccc(F)cc3)C(=O)C34CC5CC(CC(C5)C3)C4)C2=O)cc1 |
| InChI | InChI=1S/C29H31FN2O3/c1-18-2-8-24(9-3-18)32-26(33)13-25(27(32)34)31(17-19-4-6-23(30)7-5-19)28(35)29-14-20-10-21(15-29)12-22(11-20)16-29/h2-9,20-22,25H,10-17H2,1H3 |
| InChIKey | JNODEOLYIBDWMN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|