C27H33FN2O3 — CID 23832441
N-cyclohexyl-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide (PubChem CID 23832441) has the molecular formula C27H33FN2O3 and a molecular weight of 452.57 g/mol. Its IUPAC name is N-cyclohexyl-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide.
| Compound Name | N-cyclohexyl-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 23832441 |
| Molecular Formula | C27H33FN2O3 |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | N-cyclohexyl-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide |
| SMILES | O=C1CC(N(C(=O)C23CC4CC(CC(C4)C2)C3)C2CCCCC2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C27H33FN2O3/c28-20-6-8-22(9-7-20)30-24(31)13-23(25(30)32)29(21-4-2-1-3-5-21)26(33)27-14-17-10-18(15-27)12-19(11-17)16-27/h6-9,17-19,21,23H,1-5,10-16H2 |
| InChIKey | FHVZJYMKXOEABE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|