C24H25FN2O3 — CID 23832372
N-cyclohexyl-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-2-methylbenzamide (PubChem CID 23832372) has the molecular formula C24H25FN2O3 and a molecular weight of 408.47 g/mol. Its IUPAC name is N-cyclohexyl-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-2-methylbenzamide.
| Compound Name | N-cyclohexyl-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 23832372 |
| Molecular Formula | C24H25FN2O3 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-cyclohexyl-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N(C1CCCCC1)C1CC(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C24H25FN2O3/c1-16-7-5-6-10-20(16)23(29)26(18-8-3-2-4-9-18)21-15-22(28)27(24(21)30)19-13-11-17(25)12-14-19/h5-7,10-14,18,21H,2-4,8-9,15H2,1H3 |
| InChIKey | UKKGUEPRASWSHV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|