C18H21ClN2O3 — CID 23830804
N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cyclohexylacetamide (PubChem CID 23830804) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cyclohexylacetamide.
| Compound Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 23830804 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cyclohexylacetamide |
| SMILES | CC(=O)N(C1CCCCC1)C1CC(=O)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C18H21ClN2O3/c1-12(22)20(14-5-3-2-4-6-14)16-11-17(23)21(18(16)24)15-9-7-13(19)8-10-15/h7-10,14,16H,2-6,11H2,1H3 |
| InChIKey | XJALAXDHOULJCV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|