C22H20ClN3O5 — CID 23860768
N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cyclopentyl-3-nitrobenzamide (PubChem CID 23860768) has the molecular formula C22H20ClN3O5 and a molecular weight of 441.87 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cyclopentyl-3-nitrobenzamide.
| Compound Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cyclopentyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 23860768 |
| Molecular Formula | C22H20ClN3O5 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cyclopentyl-3-nitrobenzamide |
| SMILES | O=C1CC(N(C(=O)c2cccc([N+](=O)[O-])c2)C2CCCC2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20ClN3O5/c23-15-8-10-17(11-9-15)25-20(27)13-19(22(25)29)24(16-5-1-2-6-16)21(28)14-4-3-7-18(12-14)26(30)31/h3-4,7-12,16,19H,1-2,5-6,13H2 |
| InChIKey | HMUARLTWUIUQPW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|