C25H18N4O5 — CID 23888543
N-benzyl-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitrobenzamide (PubChem CID 23888543) has the molecular formula C25H18N4O5 and a molecular weight of 454.44 g/mol. Its IUPAC name is N-benzyl-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitrobenzamide.
| Compound Name | N-benzyl-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 23888543 |
| Molecular Formula | C25H18N4O5 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-benzyl-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitrobenzamide |
| SMILES | N#Cc1ccc(N2C(=O)CC(N(Cc3ccccc3)C(=O)c3cccc([N+](=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C25H18N4O5/c26-15-17-9-11-20(12-10-17)28-23(30)14-22(25(28)32)27(16-18-5-2-1-3-6-18)24(31)19-7-4-8-21(13-19)29(33)34/h1-13,22H,14,16H2 |
| InChIKey | MHCUMYRSVKKNOC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 124.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|