C24H19N3O5 — CID 23888445
N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)-3-methoxybenzamide (PubChem CID 23888445) has the molecular formula C24H19N3O5 and a molecular weight of 429.43 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)-3-methoxybenzamide.
| Compound Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 23888445 |
| Molecular Formula | C24H19N3O5 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N(Cc2ccco2)C2CC(=O)N(c3ccc(C#N)cc3)C2=O)c1 |
| InChI | InChI=1S/C24H19N3O5/c1-31-19-5-2-4-17(12-19)23(29)26(15-20-6-3-11-32-20)21-13-22(28)27(24(21)30)18-9-7-16(14-25)8-10-18/h2-12,21H,13,15H2,1H3 |
| InChIKey | PRGJRMJPHLVJNY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 103.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|