C25H24N2O6 — CID 23832242
N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)-3-methoxybenzamide (PubChem CID 23832242) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)-3-methoxybenzamide.
| Compound Name | N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 23832242 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)-3-methoxybenzamide |
| SMILES | CCOc1ccc(N2C(=O)CC(N(Cc3ccco3)C(=O)c3cccc(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C25H24N2O6/c1-3-32-19-11-9-18(10-12-19)27-23(28)15-22(25(27)30)26(16-21-8-5-13-33-21)24(29)17-6-4-7-20(14-17)31-2/h4-14,22H,3,15-16H2,1-2H3 |
| InChIKey | KZYRIHUCXOVYAY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|