C28H28N2O6 — CID 23832221
N-benzyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxybenzamide (PubChem CID 23832221) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is N-benzyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-benzyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 23832221 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-benzyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxybenzamide |
| SMILES | CCOc1ccc(N2C(=O)CC(N(Cc3ccccc3)C(=O)c3ccc(OC)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C28H28N2O6/c1-4-36-22-13-11-21(12-14-22)30-26(31)17-23(28(30)33)29(18-19-8-6-5-7-9-19)27(32)20-10-15-24(34-2)25(16-20)35-3/h5-16,23H,4,17-18H2,1-3H3 |
| InChIKey | NMUYNLZVDLHRFR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|