C28H34N2O6 — CID 23916411
N-cycloheptyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxybenzamide (PubChem CID 23916411) has the molecular formula C28H34N2O6 and a molecular weight of 494.59 g/mol. Its IUPAC name is N-cycloheptyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-cycloheptyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 23916411 |
| Molecular Formula | C28H34N2O6 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | N-cycloheptyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxybenzamide |
| SMILES | CCOc1ccc(N2C(=O)CC(N(C(=O)c3ccc(OC)c(OC)c3)C3CCCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C28H34N2O6/c1-4-36-22-14-12-21(13-15-22)30-26(31)18-23(28(30)33)29(20-9-7-5-6-8-10-20)27(32)19-11-16-24(34-2)25(17-19)35-3/h11-17,20,23H,4-10,18H2,1-3H3 |
| InChIKey | QSCPQPWHBKJASL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|