C26H31N3O7S — CID 25036502
N-cycloheptyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-3,4-dimethoxybenzamide (PubChem CID 25036502) has the molecular formula C26H31N3O7S and a molecular weight of 529.62 g/mol. Its IUPAC name is N-cycloheptyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-cycloheptyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 25036502 |
| Molecular Formula | C26H31N3O7S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | N-cycloheptyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N(C2CCCCCC2)C2CC(=O)N(c3ccc(S(N)(=O)=O)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C26H31N3O7S/c1-35-22-14-9-17(15-23(22)36-2)25(31)28(18-7-5-3-4-6-8-18)21-16-24(30)29(26(21)32)19-10-12-20(13-11-19)37(27,33)34/h9-15,18,21H,3-8,16H2,1-2H3,(H2,27,33,34) |
| InChIKey | WBRUALWFYIFOMA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|