C28H37N3O5S — CID 25042291
N-cycloheptyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]adamantane-1-carboxamide (PubChem CID 25042291) has the molecular formula C28H37N3O5S and a molecular weight of 527.69 g/mol. Its IUPAC name is N-cycloheptyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]adamantane-1-carboxamide.
| Compound Name | N-cycloheptyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 25042291 |
| Molecular Formula | C28H37N3O5S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | N-cycloheptyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]adamantane-1-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(C(=O)C34CC5CC(CC(C5)C3)C4)C3CCCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C28H37N3O5S/c29-37(35,36)23-9-7-22(8-10-23)31-25(32)14-24(26(31)33)30(21-5-3-1-2-4-6-21)27(34)28-15-18-11-19(16-28)13-20(12-18)17-28/h7-10,18-21,24H,1-6,11-17H2,(H2,29,35,36) |
| InChIKey | HGXGRCTZUKPXKE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|