C25H30N2O4 — CID 23774586
N-cyclopropyl-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide (PubChem CID 23774586) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-cyclopropyl-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide.
| Compound Name | N-cyclopropyl-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 23774586 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-cyclopropyl-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide |
| SMILES | COc1ccc(N2C(=O)CC(N(C(=O)C34CC5CC(CC(C5)C3)C4)C3CC3)C2=O)cc1 |
| InChI | InChI=1S/C25H30N2O4/c1-31-20-6-4-19(5-7-20)27-22(28)11-21(23(27)29)26(18-2-3-18)24(30)25-12-15-8-16(13-25)10-17(9-15)14-25/h4-7,15-18,21H,2-3,8-14H2,1H3 |
| InChIKey | NYHSMMOWFUFDBJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|