C30H34N4O6S — CID 25049308
N-[1-(4-carbamoylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]adamantane-1-carboxamide (PubChem CID 25049308) has the molecular formula C30H34N4O6S and a molecular weight of 578.69 g/mol. Its IUPAC name is N-[1-(4-carbamoylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]adamantane-1-carboxamide.
| Compound Name | N-[1-(4-carbamoylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 25049308 |
| Molecular Formula | C30H34N4O6S |
| Molecular Weight | 578.69 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | N-[1-(4-carbamoylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]adamantane-1-carboxamide |
| SMILES | NC(=O)c1ccc(N2C(=O)CC(N(CCc3ccc(S(N)(=O)=O)cc3)C(=O)C34CC5CC(CC(C5)C3)C4)C2=O)cc1 |
| InChI | InChI=1S/C30H34N4O6S/c31-27(36)22-3-5-23(6-4-22)34-26(35)14-25(28(34)37)33(10-9-18-1-7-24(8-2-18)41(32,39)40)29(38)30-15-19-11-20(16-30)13-21(12-19)17-30/h1-8,19-21,25H,9-17H2,(H2,31,36)(H2,32,39,40) |
| InChIKey | JPZJNDJFJSYTNU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.69 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|