C27H35N3O5S — CID 25046275
N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-3,3-dimethyl-N-[2-(4-sulfamoylphenyl)ethyl]butanamide (PubChem CID 25046275) has the molecular formula C27H35N3O5S and a molecular weight of 513.66 g/mol. Its IUPAC name is N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-3,3-dimethyl-N-[2-(4-sulfamoylphenyl)ethyl]butanamide.
| Compound Name | N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-3,3-dimethyl-N-[2-(4-sulfamoylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 25046275 |
| Molecular Formula | C27H35N3O5S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-3,3-dimethyl-N-[2-(4-sulfamoylphenyl)ethyl]butanamide |
| SMILES | CC(C)c1ccc(N2C(=O)CC(N(CCc3ccc(S(N)(=O)=O)cc3)C(=O)CC(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C27H35N3O5S/c1-18(2)20-8-10-21(11-9-20)30-24(31)16-23(26(30)33)29(25(32)17-27(3,4)5)15-14-19-6-12-22(13-7-19)36(28,34)35/h6-13,18,23H,14-17H2,1-5H3,(H2,28,34,35) |
| InChIKey | GELCGHQILXUGAS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|