C26H24BrN3O5S — CID 25048847
N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-2-phenyl-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 25048847) has the molecular formula C26H24BrN3O5S and a molecular weight of 570.47 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-2-phenyl-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-2-phenyl-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 25048847 |
| Molecular Formula | C26H24BrN3O5S |
| Molecular Weight | 570.47 g/mol |
| Exact Mass | 569.06 |
| IUPAC Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-2-phenyl-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CCN(C(=O)Cc2ccccc2)C2CC(=O)N(c3ccc(Br)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H24BrN3O5S/c27-20-8-10-21(11-9-20)30-25(32)17-23(26(30)33)29(24(31)16-19-4-2-1-3-5-19)15-14-18-6-12-22(13-7-18)36(28,34)35/h1-13,23H,14-17H2,(H2,28,34,35) |
| InChIKey | ROABHTNKPFPCLK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|