C24H22N4O5S — CID 25049124
N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-2-phenyl-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 25049124) has the molecular formula C24H22N4O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-2-phenyl-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-2-phenyl-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 25049124 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-2-phenyl-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(Cc3cccnc3)C(=O)Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H22N4O5S/c25-34(32,33)20-10-8-19(9-11-20)28-23(30)14-21(24(28)31)27(16-18-7-4-12-26-15-18)22(29)13-17-5-2-1-3-6-17/h1-12,15,21H,13-14,16H2,(H2,25,32,33) |
| InChIKey | ZUZDMBKXURMCFF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 130.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|