C25H23N3O5S — CID 25046463
N-benzyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-2-methylbenzamide (PubChem CID 25046463) has the molecular formula C25H23N3O5S and a molecular weight of 477.54 g/mol. Its IUPAC name is N-benzyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-2-methylbenzamide.
| Compound Name | N-benzyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 25046463 |
| Molecular Formula | C25H23N3O5S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-benzyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N(Cc1ccccc1)C1CC(=O)N(c2ccc(S(N)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C25H23N3O5S/c1-17-7-5-6-10-21(17)24(30)27(16-18-8-3-2-4-9-18)22-15-23(29)28(25(22)31)19-11-13-20(14-12-19)34(26,32)33/h2-14,22H,15-16H2,1H3,(H2,26,32,33) |
| InChIKey | GVTWPCXOYGLBKK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|