C21H23N3O5S — CID 25048835
N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 25048835) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 25048835 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CC(=O)N(CCc1ccc(S(N)(=O)=O)cc1)C1CC(=O)N(c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C21H23N3O5S/c1-14-3-7-17(8-4-14)24-20(26)13-19(21(24)27)23(15(2)25)12-11-16-5-9-18(10-6-16)30(22,28)29/h3-10,19H,11-13H2,1-2H3,(H2,22,28,29) |
| InChIKey | JQOMVIDEFNVYFR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|