C27H28N4O7S2 — CID 25039650
N-[4-[[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-sulfamoylphenyl)ethyl]sulfamoyl]phenyl]acetamide (PubChem CID 25039650) has the molecular formula C27H28N4O7S2 and a molecular weight of 584.68 g/mol. Its IUPAC name is N-[4-[[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-sulfamoylphenyl)ethyl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-sulfamoylphenyl)ethyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 25039650 |
| Molecular Formula | C27H28N4O7S2 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | N-[4-[[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-sulfamoylphenyl)ethyl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(CCc2ccc(S(N)(=O)=O)cc2)C2CC(=O)N(c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H28N4O7S2/c1-18-3-9-22(10-4-18)31-26(33)17-25(27(31)34)30(16-15-20-5-11-23(12-6-20)39(28,35)36)40(37,38)24-13-7-21(8-14-24)29-19(2)32/h3-14,25H,15-17H2,1-2H3,(H,29,32)(H2,28,35,36) |
| InChIKey | DTDGJGVGLBDBHP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 164.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|