C26H25N3O8S2 — CID 25038310
[4-[3-[benzenesulfonyl-[2-(4-sulfamoylphenyl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate (PubChem CID 25038310) has the molecular formula C26H25N3O8S2 and a molecular weight of 571.63 g/mol. Its IUPAC name is [4-[3-[benzenesulfonyl-[2-(4-sulfamoylphenyl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate.
| Compound Name | [4-[3-[benzenesulfonyl-[2-(4-sulfamoylphenyl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 25038310 |
| Molecular Formula | C26H25N3O8S2 |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | [4-[3-[benzenesulfonyl-[2-(4-sulfamoylphenyl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)CC(N(CCc3ccc(S(N)(=O)=O)cc3)S(=O)(=O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C26H25N3O8S2/c1-18(30)37-21-11-9-20(10-12-21)29-25(31)17-24(26(29)32)28(39(35,36)23-5-3-2-4-6-23)16-15-19-7-13-22(14-8-19)38(27,33)34/h2-14,24H,15-17H2,1H3,(H2,27,33,34) |
| InChIKey | XPEBUJWXVFJDSW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 161.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|