C26H23BrN2O6S — CID 23998527
methyl 4-[3-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23998527) has the molecular formula C26H23BrN2O6S and a molecular weight of 571.45 g/mol. Its IUPAC name is methyl 4-[3-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[3-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23998527 |
| Molecular Formula | C26H23BrN2O6S |
| Molecular Weight | 571.45 g/mol |
| Exact Mass | 570.05 |
| IUPAC Name | methyl 4-[3-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)CC(N(CCc3ccccc3)S(=O)(=O)c3ccc(Br)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H23BrN2O6S/c1-35-26(32)19-7-11-21(12-8-19)29-24(30)17-23(25(29)31)28(16-15-18-5-3-2-4-6-18)36(33,34)22-13-9-20(27)10-14-22/h2-14,23H,15-17H2,1H3 |
| InChIKey | IAQJBOKHPWUYDQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|