C25H23FN2O4S — CID 23998649
4-fluoro-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)benzenesulfonamide (PubChem CID 23998649) has the molecular formula C25H23FN2O4S and a molecular weight of 466.53 g/mol. Its IUPAC name is 4-fluoro-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23998649 |
| Molecular Formula | C25H23FN2O4S |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 4-fluoro-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)benzenesulfonamide |
| SMILES | Cc1ccc(N2C(=O)CC(N(CCc3ccccc3)S(=O)(=O)c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H23FN2O4S/c1-18-7-11-21(12-8-18)28-24(29)17-23(25(28)30)27(16-15-19-5-3-2-4-6-19)33(31,32)22-13-9-20(26)10-14-22/h2-14,23H,15-17H2,1H3 |
| InChIKey | ZALYYWLKIOICCQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|