C27H28N2O6S — CID 23772801
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide (PubChem CID 23772801) has the molecular formula C27H28N2O6S and a molecular weight of 508.60 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23772801 |
| Molecular Formula | C27H28N2O6S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
| SMILES | COc1ccc(CCN(C2CC(=O)N(c3ccc(C)cc3)C2=O)S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C27H28N2O6S/c1-19-9-12-21(13-10-19)29-26(30)18-23(27(29)31)28(36(32,33)22-7-5-4-6-8-22)16-15-20-11-14-24(34-2)25(17-20)35-3/h4-14,17,23H,15-16,18H2,1-3H3 |
| InChIKey | NPHDBNFBXKTRKR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|