C27H27IN2O6S — CID 23830573
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methylbenzenesulfonamide (PubChem CID 23830573) has the molecular formula C27H27IN2O6S and a molecular weight of 634.49 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 23830573 |
| Molecular Formula | C27H27IN2O6S |
| Molecular Weight | 634.49 g/mol |
| Exact Mass | 634.06 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(CCN(C2CC(=O)N(c3ccc(I)cc3)C2=O)S(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C27H27IN2O6S/c1-18-4-11-22(12-5-18)37(33,34)29(15-14-19-6-13-24(35-2)25(16-19)36-3)23-17-26(31)30(27(23)32)21-9-7-20(28)8-10-21/h4-13,16,23H,14-15,17H2,1-3H3 |
| InChIKey | XHIZUPMQJHKRGK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|