C25H27IN2O5S — CID 23801804
N-[2-(cyclohexen-1-yl)ethyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzenesulfonamide (PubChem CID 23801804) has the molecular formula C25H27IN2O5S and a molecular weight of 594.47 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 23801804 |
| Molecular Formula | C25H27IN2O5S |
| Molecular Weight | 594.47 g/mol |
| Exact Mass | 594.07 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCC2=CCCCC2)C2CC(=O)N(c3ccc(I)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H27IN2O5S/c1-33-21-11-13-22(14-12-21)34(31,32)27(16-15-18-5-3-2-4-6-18)23-17-24(29)28(25(23)30)20-9-7-19(26)8-10-20/h5,7-14,23H,2-4,6,15-17H2,1H3 |
| InChIKey | DKDOWADZGKNHTC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|