C27H29FN2O6S — CID 23942774
ethyl 4-[3-[2-(cyclohexen-1-yl)ethyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23942774) has the molecular formula C27H29FN2O6S and a molecular weight of 528.60 g/mol. Its IUPAC name is ethyl 4-[3-[2-(cyclohexen-1-yl)ethyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[2-(cyclohexen-1-yl)ethyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23942774 |
| Molecular Formula | C27H29FN2O6S |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | ethyl 4-[3-[2-(cyclohexen-1-yl)ethyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N(CCC3=CCCCC3)S(=O)(=O)c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H29FN2O6S/c1-2-36-27(33)20-8-12-22(13-9-20)30-25(31)18-24(26(30)32)29(17-16-19-6-4-3-5-7-19)37(34,35)23-14-10-21(28)11-15-23/h6,8-15,24H,2-5,7,16-18H2,1H3 |
| InChIKey | LGZRWBUXWHCKEV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|