C27H23ClN2O8S — CID 23970725
ethyl 4-[3-[1,3-benzodioxol-5-ylmethyl-(4-chlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23970725) has the molecular formula C27H23ClN2O8S and a molecular weight of 571.01 g/mol. Its IUPAC name is ethyl 4-[3-[1,3-benzodioxol-5-ylmethyl-(4-chlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[1,3-benzodioxol-5-ylmethyl-(4-chlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23970725 |
| Molecular Formula | C27H23ClN2O8S |
| Molecular Weight | 571.01 g/mol |
| Exact Mass | 570.09 |
| IUPAC Name | ethyl 4-[3-[1,3-benzodioxol-5-ylmethyl-(4-chlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N(Cc3ccc4c(c3)OCO4)S(=O)(=O)c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H23ClN2O8S/c1-2-36-27(33)18-4-8-20(9-5-18)30-25(31)14-22(26(30)32)29(39(34,35)21-10-6-19(28)7-11-21)15-17-3-12-23-24(13-17)38-16-37-23/h3-13,22H,2,14-16H2,1H3 |
| InChIKey | DYYWPIOIVHPNTC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.01 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|