C25H21ClN2O7S — CID 23942840
N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzenesulfonamide (PubChem CID 23942840) has the molecular formula C25H21ClN2O7S and a molecular weight of 528.97 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 23942840 |
| Molecular Formula | C25H21ClN2O7S |
| Molecular Weight | 528.97 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccc3c(c2)OCO3)C2CC(=O)N(c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H21ClN2O7S/c1-33-19-7-9-20(10-8-19)36(31,32)27(14-16-2-11-22-23(12-16)35-15-34-22)21-13-24(29)28(25(21)30)18-5-3-17(26)4-6-18/h2-12,21H,13-15H2,1H3 |
| InChIKey | IGJAAHKMMFSUHV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.97 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|