C24H22N2O5S — CID 23772824
N-benzyl-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide (PubChem CID 23772824) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is N-benzyl-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | N-benzyl-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23772824 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-benzyl-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
| SMILES | COc1ccc(N2C(=O)CC(N(Cc3ccccc3)S(=O)(=O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H22N2O5S/c1-31-20-14-12-19(13-15-20)26-23(27)16-22(24(26)28)25(17-18-8-4-2-5-9-18)32(29,30)21-10-6-3-7-11-21/h2-15,22H,16-17H2,1H3 |
| InChIKey | OBURDSNIEHBRNS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|