C30H23N3O5S — CID 23830780
N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-benzylbenzenesulfonamide (PubChem CID 23830780) has the molecular formula C30H23N3O5S and a molecular weight of 537.60 g/mol. Its IUPAC name is N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-benzylbenzenesulfonamide.
| Compound Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-benzylbenzenesulfonamide |
|---|---|
| PubChem CID | 23830780 |
| Molecular Formula | C30H23N3O5S |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-benzylbenzenesulfonamide |
| SMILES | O=C1CC(N(Cc2ccccc2)S(=O)(=O)c2ccccc2)C(=O)N1c1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C30H23N3O5S/c34-28-19-26(32(20-21-9-3-1-4-10-21)39(36,37)24-11-5-2-6-12-24)30(35)33(28)23-17-15-22(16-18-23)29-31-25-13-7-8-14-27(25)38-29/h1-18,26H,19-20H2 |
| InChIKey | COYYDWXTJKUCDR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|