C32H25FN4O6S — CID 23886921
N-[4-[[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-[(4-fluorophenyl)methyl]sulfamoyl]phenyl]acetamide (PubChem CID 23886921) has the molecular formula C32H25FN4O6S and a molecular weight of 612.64 g/mol. Its IUPAC name is N-[4-[[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-[(4-fluorophenyl)methyl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-[(4-fluorophenyl)methyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 23886921 |
| Molecular Formula | C32H25FN4O6S |
| Molecular Weight | 612.64 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | N-[4-[[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-[(4-fluorophenyl)methyl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(Cc2ccc(F)cc2)C2CC(=O)N(c3ccc(-c4nc5ccccc5o4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C32H25FN4O6S/c1-20(38)34-24-12-16-26(17-13-24)44(41,42)36(19-21-6-10-23(33)11-7-21)28-18-30(39)37(32(28)40)25-14-8-22(9-15-25)31-35-27-4-2-3-5-29(27)43-31/h2-17,28H,18-19H2,1H3,(H,34,38) |
| InChIKey | DBFGSLNKCSZPGY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.64 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|