C28H28N4O6S — CID 23830681
N-[4-[3-[(4-acetamidophenyl)sulfonyl-[(4-methylphenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 23830681) has the molecular formula C28H28N4O6S and a molecular weight of 548.62 g/mol. Its IUPAC name is N-[4-[3-[(4-acetamidophenyl)sulfonyl-[(4-methylphenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[3-[(4-acetamidophenyl)sulfonyl-[(4-methylphenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 23830681 |
| Molecular Formula | C28H28N4O6S |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | N-[4-[3-[(4-acetamidophenyl)sulfonyl-[(4-methylphenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)CC(N(Cc3ccc(C)cc3)S(=O)(=O)c3ccc(NC(C)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C28H28N4O6S/c1-18-4-6-21(7-5-18)17-31(39(37,38)25-14-10-23(11-15-25)30-20(3)34)26-16-27(35)32(28(26)36)24-12-8-22(9-13-24)29-19(2)33/h4-15,26H,16-17H2,1-3H3,(H,29,33)(H,30,34) |
| InChIKey | UQBCVDLMDYWHGX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|