C26H24N4O7S — CID 23886806
[4-[3-[(4-acetamidophenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate (PubChem CID 23886806) has the molecular formula C26H24N4O7S and a molecular weight of 536.57 g/mol. Its IUPAC name is [4-[3-[(4-acetamidophenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate.
| Compound Name | [4-[3-[(4-acetamidophenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 23886806 |
| Molecular Formula | C26H24N4O7S |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | [4-[3-[(4-acetamidophenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(Cc2cccnc2)C2CC(=O)N(c3ccc(OC(C)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H24N4O7S/c1-17(31)28-20-5-11-23(12-6-20)38(35,36)29(16-19-4-3-13-27-15-19)24-14-25(33)30(26(24)34)21-7-9-22(10-8-21)37-18(2)32/h3-13,15,24H,14,16H2,1-2H3,(H,28,31) |
| InChIKey | SIKDTYQPACGZLG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 143.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|