C22H17BrClN3O4S — CID 23998599
4-bromo-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)benzenesulfonamide (PubChem CID 23998599) has the molecular formula C22H17BrClN3O4S and a molecular weight of 534.82 g/mol. Its IUPAC name is 4-bromo-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 4-bromo-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23998599 |
| Molecular Formula | C22H17BrClN3O4S |
| Molecular Weight | 534.82 g/mol |
| Exact Mass | 532.98 |
| IUPAC Name | 4-bromo-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)benzenesulfonamide |
| SMILES | O=C1CC(N(Cc2cccnc2)S(=O)(=O)c2ccc(Br)cc2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H17BrClN3O4S/c23-16-3-9-19(10-4-16)32(30,31)26(14-15-2-1-11-25-13-15)20-12-21(28)27(22(20)29)18-7-5-17(24)6-8-18/h1-11,13,20H,12,14H2 |
| InChIKey | RIHWIJLOUPKOKS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.82 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|