C25H23ClN2O4S — CID 23859022
N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methyl-N-(2-phenylethyl)benzenesulfonamide (PubChem CID 23859022) has the molecular formula C25H23ClN2O4S and a molecular weight of 482.99 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methyl-N-(2-phenylethyl)benzenesulfonamide.
| Compound Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methyl-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23859022 |
| Molecular Formula | C25H23ClN2O4S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methyl-N-(2-phenylethyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCc2ccccc2)C2CC(=O)N(c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H23ClN2O4S/c1-18-7-13-22(14-8-18)33(31,32)27(16-15-19-5-3-2-4-6-19)23-17-24(29)28(25(23)30)21-11-9-20(26)10-12-21/h2-14,23H,15-17H2,1H3 |
| InChIKey | HFPCTKZMKPGMNS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|