C24H22ClN3O6S2 — CID 25048801
4-[2-[(4-chlorophenyl)sulfonyl-(2,5-dioxo-1-phenylpyrrolidin-3-yl)amino]ethyl]benzenesulfonamide (PubChem CID 25048801) has the molecular formula C24H22ClN3O6S2 and a molecular weight of 548.04 g/mol. Its IUPAC name is 4-[2-[(4-chlorophenyl)sulfonyl-(2,5-dioxo-1-phenylpyrrolidin-3-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(4-chlorophenyl)sulfonyl-(2,5-dioxo-1-phenylpyrrolidin-3-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25048801 |
| Molecular Formula | C24H22ClN3O6S2 |
| Molecular Weight | 548.04 g/mol |
| Exact Mass | 547.06 |
| IUPAC Name | 4-[2-[(4-chlorophenyl)sulfonyl-(2,5-dioxo-1-phenylpyrrolidin-3-yl)amino]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCN(C2CC(=O)N(c3ccccc3)C2=O)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H22ClN3O6S2/c25-18-8-12-21(13-9-18)36(33,34)27(15-14-17-6-10-20(11-7-17)35(26,31)32)22-16-23(29)28(24(22)30)19-4-2-1-3-5-19/h1-13,22H,14-16H2,(H2,26,31,32) |
| InChIKey | DQLLRRNVFXCRFP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.04 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|