C24H20Cl2FN3O6S2 — CID 25037926
2,5-dichloro-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide (PubChem CID 25037926) has the molecular formula C24H20Cl2FN3O6S2 and a molecular weight of 600.48 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25037926 |
| Molecular Formula | C24H20Cl2FN3O6S2 |
| Molecular Weight | 600.48 g/mol |
| Exact Mass | 599.02 |
| IUPAC Name | 2,5-dichloro-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCN(C2CC(=O)N(c3ccc(F)cc3)C2=O)S(=O)(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C24H20Cl2FN3O6S2/c25-16-3-10-20(26)22(13-16)38(35,36)29(12-11-15-1-8-19(9-2-15)37(28,33)34)21-14-23(31)30(24(21)32)18-6-4-17(27)5-7-18/h1-10,13,21H,11-12,14H2,(H2,28,33,34) |
| InChIKey | MFPQBRXWOYUOIV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|