C26H24Cl2N2O6S — CID 23886824
4-chloro-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]benzenesulfonamide (PubChem CID 23886824) has the molecular formula C26H24Cl2N2O6S and a molecular weight of 563.46 g/mol. Its IUPAC name is 4-chloro-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23886824 |
| Molecular Formula | C26H24Cl2N2O6S |
| Molecular Weight | 563.46 g/mol |
| Exact Mass | 562.07 |
| IUPAC Name | 4-chloro-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(CCN(C2CC(=O)N(c3ccc(Cl)cc3)C2=O)S(=O)(=O)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C26H24Cl2N2O6S/c1-35-23-12-3-17(15-24(23)36-2)13-14-29(37(33,34)21-10-6-19(28)7-11-21)22-16-25(31)30(26(22)32)20-8-4-18(27)5-9-20/h3-12,15,22H,13-14,16H2,1-2H3 |
| InChIKey | QAHVIELGXBLZAE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|