C28H28FN3O7S — CID 23743594
N-[4-[3-[2-(3,4-dimethoxyphenyl)ethyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 23743594) has the molecular formula C28H28FN3O7S and a molecular weight of 569.61 g/mol. Its IUPAC name is N-[4-[3-[2-(3,4-dimethoxyphenyl)ethyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[3-[2-(3,4-dimethoxyphenyl)ethyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 23743594 |
| Molecular Formula | C28H28FN3O7S |
| Molecular Weight | 569.61 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | N-[4-[3-[2-(3,4-dimethoxyphenyl)ethyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | COc1ccc(CCN(C2CC(=O)N(c3ccc(NC(C)=O)cc3)C2=O)S(=O)(=O)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C28H28FN3O7S/c1-18(33)30-21-7-9-22(10-8-21)32-27(34)17-24(28(32)35)31(40(36,37)23-11-5-20(29)6-12-23)15-14-19-4-13-25(38-2)26(16-19)39-3/h4-13,16,24H,14-15,17H2,1-3H3,(H,30,33) |
| InChIKey | XZLIKHRKZSYUMP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.61 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|