C30H30FN3O6S — CID 3540175
ethyl 4-[3-[2-(3,4-dimethoxyphenyl)ethyl-[(4-fluorophenyl)carbamothioyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 3540175) has the molecular formula C30H30FN3O6S and a molecular weight of 579.65 g/mol. Its IUPAC name is ethyl 4-[3-[2-(3,4-dimethoxyphenyl)ethyl-[(4-fluorophenyl)carbamothioyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[2-(3,4-dimethoxyphenyl)ethyl-[(4-fluorophenyl)carbamothioyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 3540175 |
| Molecular Formula | C30H30FN3O6S |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | ethyl 4-[3-[2-(3,4-dimethoxyphenyl)ethyl-[(4-fluorophenyl)carbamothioyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N(CCc3ccc(OC)c(OC)c3)C(=S)Nc3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C30H30FN3O6S/c1-4-40-29(37)20-6-12-23(13-7-20)34-27(35)18-24(28(34)36)33(30(41)32-22-10-8-21(31)9-11-22)16-15-19-5-14-25(38-2)26(17-19)39-3/h5-14,17,24H,4,15-16,18H2,1-3H3,(H,32,41) |
| InChIKey | BYIDBMYTYOSUOO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|