C27H26FN3O4S — CID 23794333
3-(4-fluorophenyl)-1-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-1-[2-(4-methoxyphenyl)ethyl]thiourea (PubChem CID 23794333) has the molecular formula C27H26FN3O4S and a molecular weight of 507.59 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-1-[2-(4-methoxyphenyl)ethyl]thiourea.
| Compound Name | 3-(4-fluorophenyl)-1-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-1-[2-(4-methoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 23794333 |
| Molecular Formula | C27H26FN3O4S |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 3-(4-fluorophenyl)-1-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-1-[2-(4-methoxyphenyl)ethyl]thiourea |
| SMILES | COc1ccc(CCN(C(=S)Nc2ccc(F)cc2)C2CC(=O)N(c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H26FN3O4S/c1-34-22-11-3-18(4-12-22)15-16-30(27(36)29-20-7-5-19(28)6-8-20)24-17-25(32)31(26(24)33)21-9-13-23(35-2)14-10-21/h3-14,24H,15-17H2,1-2H3,(H,29,36) |
| InChIKey | OIPSFQZOCPAPJN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|